C15H14FNO3P+ — CID 175359914
[(1S)-2-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-1-yl]oxy-hydroxy-oxophosphanium (PubChem CID 175359914) has the molecular formula C15H14FNO3P+ and a molecular weight of 306.25 g/mol. Its IUPAC name is [(1S)-2-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-1-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(1S)-2-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-1-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 175359914 |
| Molecular Formula | C15H14FNO3P+ |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | [(1S)-2-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-1-yl]oxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)O[C@H]1c2ccccc2CCN1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H13FNO3P/c16-12-5-7-13(8-6-12)17-10-9-11-3-1-2-4-14(11)15(17)20-21(18)19/h1-8,15H,9-10H2/p+1/t15-/m0/s1 |
| InChIKey | WUFTZBILUVJWTG-HNNXBMFYSA-O |
| XLogP | 3.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|