C16H17N — CID 3383161
2-(4-ethylphenyl)-1,3-dihydroisoindole (PubChem CID 3383161) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1,3-dihydroisoindole.
| Compound Name | 2-(4-ethylphenyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 3383161 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-(4-ethylphenyl)-1,3-dihydroisoindole |
| SMILES | CCc1ccc(N2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C16H17N/c1-2-13-7-9-16(10-8-13)17-11-14-5-3-4-6-15(14)12-17/h3-10H,2,11-12H2,1H3 |
| InChIKey | IMIWWBWMGMXCJY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|