C18H22N2 — CID 117015537
5-(4-ethylphenyl)-2,3,4,6-tetrahydro-1H-2,5-benzodiazocine (PubChem CID 117015537) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-2,3,4,6-tetrahydro-1H-2,5-benzodiazocine.
| Compound Name | 5-(4-ethylphenyl)-2,3,4,6-tetrahydro-1H-2,5-benzodiazocine |
|---|---|
| PubChem CID | 117015537 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 5-(4-ethylphenyl)-2,3,4,6-tetrahydro-1H-2,5-benzodiazocine |
| SMILES | CCc1ccc(N2CCNCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C18H22N2/c1-2-15-7-9-18(10-8-15)20-12-11-19-13-16-5-3-4-6-17(16)14-20/h3-10,19H,2,11-14H2,1H3 |
| InChIKey | VMKMMHAZJDZLEV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|