C27H22Cl2NOP — CID 71567691
1-bis(3-chlorophenyl)phosphoryl-2-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 71567691) has the molecular formula C27H22Cl2NOP and a molecular weight of 478.36 g/mol. Its IUPAC name is 1-bis(3-chlorophenyl)phosphoryl-2-phenyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-bis(3-chlorophenyl)phosphoryl-2-phenyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 71567691 |
| Molecular Formula | C27H22Cl2NOP |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 1-bis(3-chlorophenyl)phosphoryl-2-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | O=P(c1cccc(Cl)c1)(c1cccc(Cl)c1)C1c2ccccc2CCN1c1ccccc1 |
| InChI | InChI=1S/C27H22Cl2NOP/c28-21-9-6-13-24(18-21)32(31,25-14-7-10-22(29)19-25)27-26-15-5-4-8-20(26)16-17-30(27)23-11-2-1-3-12-23/h1-15,18-19,27H,16-17H2 |
| InChIKey | MFARUESTWKWLQV-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|