C20H16ClN3O — CID 3359789
15-(3-chlorophenyl)-10,14,15-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-11-one (PubChem CID 3359789) has the molecular formula C20H16ClN3O and a molecular weight of 349.82 g/mol. Its IUPAC name is 15-(3-chlorophenyl)-10,14,15-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-11-one.
| Compound Name | 15-(3-chlorophenyl)-10,14,15-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-11-one |
|---|---|
| PubChem CID | 3359789 |
| Molecular Formula | C20H16ClN3O |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 15-(3-chlorophenyl)-10,14,15-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-11-one |
| SMILES | O=C1c2cnn(-c3cccc(Cl)c3)c2CC2c3ccccc3CCN12 |
| InChI | InChI=1S/C20H16ClN3O/c21-14-5-3-6-15(10-14)24-19-11-18-16-7-2-1-4-13(16)8-9-23(18)20(25)17(19)12-22-24/h1-7,10,12,18H,8-9,11H2 |
| InChIKey | ASDMGXYDKTZBMI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |