C30H33N3O2 — CID 132575524
N-cyclohexyl-2-[(4-methylphenyl)methyl]-N-(pyridine-3-carbonyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 132575524) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4-methylphenyl)methyl]-N-(pyridine-3-carbonyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | N-cyclohexyl-2-[(4-methylphenyl)methyl]-N-(pyridine-3-carbonyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 132575524 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | N-cyclohexyl-2-[(4-methylphenyl)methyl]-N-(pyridine-3-carbonyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | Cc1ccc(CN2CCc3ccccc3C2C(=O)N(C(=O)c2cccnc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H33N3O2/c1-22-13-15-23(16-14-22)21-32-19-17-24-8-5-6-12-27(24)28(32)30(35)33(26-10-3-2-4-11-26)29(34)25-9-7-18-31-20-25/h5-9,12-16,18,20,26,28H,2-4,10-11,17,19,21H2,1H3 |
| InChIKey | GTKYZYQMJSTAMM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|