C20H23NO — CID 102483415
(1S)-2-[(4-methoxyphenyl)methyl]-1-[(E)-prop-1-enyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 102483415) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (1S)-2-[(4-methoxyphenyl)methyl]-1-[(E)-prop-1-enyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1S)-2-[(4-methoxyphenyl)methyl]-1-[(E)-prop-1-enyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 102483415 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (1S)-2-[(4-methoxyphenyl)methyl]-1-[(E)-prop-1-enyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | C/C=C/[C@H]1c2ccccc2CCN1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H23NO/c1-3-6-20-19-8-5-4-7-17(19)13-14-21(20)15-16-9-11-18(22-2)12-10-16/h3-12,20H,13-15H2,1-2H3/b6-3+/t20-/m0/s1 |
| InChIKey | DIIXWSFZXKTDEV-QLPSFHHPSA-N |
| XLogP | 4.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|