C12H19ClN4O2 — CID 114433549
N-[2-[(1-butyl-5-chloro-6-oxopyridazin-4-yl)amino]ethyl]acetamide (PubChem CID 114433549) has the molecular formula C12H19ClN4O2 and a molecular weight of 286.76 g/mol. Its IUPAC name is N-[2-[(1-butyl-5-chloro-6-oxopyridazin-4-yl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(1-butyl-5-chloro-6-oxopyridazin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 114433549 |
| Molecular Formula | C12H19ClN4O2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-[2-[(1-butyl-5-chloro-6-oxopyridazin-4-yl)amino]ethyl]acetamide |
| SMILES | CCCCn1ncc(NCCNC(C)=O)c(Cl)c1=O |
| InChI | InChI=1S/C12H19ClN4O2/c1-3-4-7-17-12(19)11(13)10(8-16-17)15-6-5-14-9(2)18/h8,15H,3-7H2,1-2H3,(H,14,18) |
| InChIKey | CFUBENBWKZEEQI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|