C17H23ClN4O — CID 15581001
5-[2-(benzylamino)ethylamino]-2-butyl-4-chloropyridazin-3-one (PubChem CID 15581001) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 5-[2-(benzylamino)ethylamino]-2-butyl-4-chloropyridazin-3-one.
| Compound Name | 5-[2-(benzylamino)ethylamino]-2-butyl-4-chloropyridazin-3-one |
|---|---|
| PubChem CID | 15581001 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 5-[2-(benzylamino)ethylamino]-2-butyl-4-chloropyridazin-3-one |
| SMILES | CCCCn1ncc(NCCNCc2ccccc2)c(Cl)c1=O |
| InChI | InChI=1S/C17H23ClN4O/c1-2-3-11-22-17(23)16(18)15(13-21-22)20-10-9-19-12-14-7-5-4-6-8-14/h4-8,13,19-20H,2-3,9-12H2,1H3 |
| InChIKey | SKZJNEFPRPMLHK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|