C16H14BrN3O — CID 114433793
5-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)-4-bromo-2-prop-2-ynylpyridazin-3-one (PubChem CID 114433793) has the molecular formula C16H14BrN3O and a molecular weight of 344.21 g/mol. Its IUPAC name is 5-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)-4-bromo-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 5-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)-4-bromo-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114433793 |
| Molecular Formula | C16H14BrN3O |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 5-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)-4-bromo-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(NCC2Cc3ccccc32)c(Br)c1=O |
| InChI | InChI=1S/C16H14BrN3O/c1-2-7-20-16(21)15(17)14(10-19-20)18-9-12-8-11-5-3-4-6-13(11)12/h1,3-6,10,12,18H,7-9H2 |
| InChIKey | YZRKYWUYRSGGKH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|