C13H21BrN4O2 — CID 114434748
4-bromo-5-[(1-ethylpiperidin-4-yl)amino]-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114434748) has the molecular formula C13H21BrN4O2 and a molecular weight of 345.24 g/mol. Its IUPAC name is 4-bromo-5-[(1-ethylpiperidin-4-yl)amino]-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 4-bromo-5-[(1-ethylpiperidin-4-yl)amino]-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114434748 |
| Molecular Formula | C13H21BrN4O2 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-bromo-5-[(1-ethylpiperidin-4-yl)amino]-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | CCN1CCC(Nc2cnn(CCO)c(=O)c2Br)CC1 |
| InChI | InChI=1S/C13H21BrN4O2/c1-2-17-5-3-10(4-6-17)16-11-9-15-18(7-8-19)13(20)12(11)14/h9-10,16,19H,2-8H2,1H3 |
| InChIKey | OGQYWJSKWXMLFB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |