C12H17BrN4O3 — CID 114438997
4-bromo-2-(2-hydroxyethyl)-5-[(1-methyl-6-oxopiperidin-3-yl)amino]pyridazin-3-one (PubChem CID 114438997) has the molecular formula C12H17BrN4O3 and a molecular weight of 345.20 g/mol. Its IUPAC name is 4-bromo-2-(2-hydroxyethyl)-5-[(1-methyl-6-oxopiperidin-3-yl)amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-hydroxyethyl)-5-[(1-methyl-6-oxopiperidin-3-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114438997 |
| Molecular Formula | C12H17BrN4O3 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 4-bromo-2-(2-hydroxyethyl)-5-[(1-methyl-6-oxopiperidin-3-yl)amino]pyridazin-3-one |
| SMILES | CN1CC(Nc2cnn(CCO)c(=O)c2Br)CCC1=O |
| InChI | InChI=1S/C12H17BrN4O3/c1-16-7-8(2-3-10(16)19)15-9-6-14-17(4-5-18)12(20)11(9)13/h6,8,15,18H,2-5,7H2,1H3 |
| InChIKey | KBZJHUXRYSWIML-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |