C12H19BrN4O3 — CID 114446097
5-[(2-amino-4-ethoxycyclobutyl)amino]-4-bromo-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114446097) has the molecular formula C12H19BrN4O3 and a molecular weight of 347.21 g/mol. Its IUPAC name is 5-[(2-amino-4-ethoxycyclobutyl)amino]-4-bromo-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 5-[(2-amino-4-ethoxycyclobutyl)amino]-4-bromo-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114446097 |
| Molecular Formula | C12H19BrN4O3 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 5-[(2-amino-4-ethoxycyclobutyl)amino]-4-bromo-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | CCOC1CC(N)C1Nc1cnn(CCO)c(=O)c1Br |
| InChI | InChI=1S/C12H19BrN4O3/c1-2-20-9-5-7(14)11(9)16-8-6-15-17(3-4-18)12(19)10(8)13/h6-7,9,11,16,18H,2-5,14H2,1H3 |
| InChIKey | RXWRRGBMASLQOQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |