C14H21ClN4O2 — CID 114438991
2-butyl-4-chloro-5-[(1-methyl-6-oxopiperidin-3-yl)amino]pyridazin-3-one (PubChem CID 114438991) has the molecular formula C14H21ClN4O2 and a molecular weight of 312.80 g/mol. Its IUPAC name is 2-butyl-4-chloro-5-[(1-methyl-6-oxopiperidin-3-yl)amino]pyridazin-3-one.
| Compound Name | 2-butyl-4-chloro-5-[(1-methyl-6-oxopiperidin-3-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114438991 |
| Molecular Formula | C14H21ClN4O2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-butyl-4-chloro-5-[(1-methyl-6-oxopiperidin-3-yl)amino]pyridazin-3-one |
| SMILES | CCCCn1ncc(NC2CCC(=O)N(C)C2)c(Cl)c1=O |
| InChI | InChI=1S/C14H21ClN4O2/c1-3-4-7-19-14(21)13(15)11(8-16-19)17-10-5-6-12(20)18(2)9-10/h8,10,17H,3-7,9H2,1-2H3 |
| InChIKey | ISPKMULRNBCPOF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |