C13H19BrN4O3 — CID 114434910
methyl 2-[5-bromo-4-[(1-methylpiperidin-3-yl)amino]-6-oxopyridazin-1-yl]acetate (PubChem CID 114434910) has the molecular formula C13H19BrN4O3 and a molecular weight of 359.22 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-[(1-methylpiperidin-3-yl)amino]-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-bromo-4-[(1-methylpiperidin-3-yl)amino]-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114434910 |
| Molecular Formula | C13H19BrN4O3 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | methyl 2-[5-bromo-4-[(1-methylpiperidin-3-yl)amino]-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NC2CCCN(C)C2)c(Br)c1=O |
| InChI | InChI=1S/C13H19BrN4O3/c1-17-5-3-4-9(7-17)16-10-6-15-18(8-11(19)21-2)13(20)12(10)14/h6,9,16H,3-5,7-8H2,1-2H3 |
| InChIKey | YEEPODHIMORULO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |