C11H14BrN3O3S — CID 103063484
methyl 2-[5-bromo-6-oxo-4-(thiolan-3-ylamino)pyridazin-1-yl]acetate (PubChem CID 103063484) has the molecular formula C11H14BrN3O3S and a molecular weight of 348.22 g/mol. Its IUPAC name is methyl 2-[5-bromo-6-oxo-4-(thiolan-3-ylamino)pyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-bromo-6-oxo-4-(thiolan-3-ylamino)pyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 103063484 |
| Molecular Formula | C11H14BrN3O3S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | methyl 2-[5-bromo-6-oxo-4-(thiolan-3-ylamino)pyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NC2CCSC2)c(Br)c1=O |
| InChI | InChI=1S/C11H14BrN3O3S/c1-18-9(16)5-15-11(17)10(12)8(4-13-15)14-7-2-3-19-6-7/h4,7,14H,2-3,5-6H2,1H3 |
| InChIKey | ATYAESIPUZUNMF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |