C15H24ClN3O — CID 114435325
5-chloro-2-(cyclobutylmethyl)-4-(3-methylpentan-2-ylamino)pyridazin-3-one (PubChem CID 114435325) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 5-chloro-2-(cyclobutylmethyl)-4-(3-methylpentan-2-ylamino)pyridazin-3-one.
| Compound Name | 5-chloro-2-(cyclobutylmethyl)-4-(3-methylpentan-2-ylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114435325 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 5-chloro-2-(cyclobutylmethyl)-4-(3-methylpentan-2-ylamino)pyridazin-3-one |
| SMILES | CCC(C)C(C)Nc1c(Cl)cnn(CC2CCC2)c1=O |
| InChI | InChI=1S/C15H24ClN3O/c1-4-10(2)11(3)18-14-13(16)8-17-19(15(14)20)9-12-6-5-7-12/h8,10-12,18H,4-7,9H2,1-3H3 |
| InChIKey | GLFINXPLLGGRPE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |