C14H22ClN3O2 — CID 114438636
5-chloro-2-(cyclobutylmethyl)-4-(1-methoxybutan-2-ylamino)pyridazin-3-one (PubChem CID 114438636) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 5-chloro-2-(cyclobutylmethyl)-4-(1-methoxybutan-2-ylamino)pyridazin-3-one.
| Compound Name | 5-chloro-2-(cyclobutylmethyl)-4-(1-methoxybutan-2-ylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114438636 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 5-chloro-2-(cyclobutylmethyl)-4-(1-methoxybutan-2-ylamino)pyridazin-3-one |
| SMILES | CCC(COC)Nc1c(Cl)cnn(CC2CCC2)c1=O |
| InChI | InChI=1S/C14H22ClN3O2/c1-3-11(9-20-2)17-13-12(15)7-16-18(14(13)19)8-10-5-4-6-10/h7,10-11,17H,3-6,8-9H2,1-2H3 |
| InChIKey | AJXXCAMRTRRCMQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |