C14H22ClN3O3 — CID 106248172
5-chloro-2-(cyclobutylmethyl)-4-[(3-hydroxy-4-methoxybutyl)amino]pyridazin-3-one (PubChem CID 106248172) has the molecular formula C14H22ClN3O3 and a molecular weight of 315.80 g/mol. Its IUPAC name is 5-chloro-2-(cyclobutylmethyl)-4-[(3-hydroxy-4-methoxybutyl)amino]pyridazin-3-one.
| Compound Name | 5-chloro-2-(cyclobutylmethyl)-4-[(3-hydroxy-4-methoxybutyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 106248172 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 5-chloro-2-(cyclobutylmethyl)-4-[(3-hydroxy-4-methoxybutyl)amino]pyridazin-3-one |
| SMILES | COCC(O)CCNc1c(Cl)cnn(CC2CCC2)c1=O |
| InChI | InChI=1S/C14H22ClN3O3/c1-21-9-11(19)5-6-16-13-12(15)7-17-18(14(13)20)8-10-3-2-4-10/h7,10-11,16,19H,2-6,8-9H2,1H3 |
| InChIKey | IRBCJUBDXUXKTA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |