C12H15ClF3N3OS — CID 106430881
5-chloro-2-(cyclobutylmethyl)-4-[2-(trifluoromethylsulfanyl)ethylamino]pyridazin-3-one (PubChem CID 106430881) has the molecular formula C12H15ClF3N3OS and a molecular weight of 341.79 g/mol. Its IUPAC name is 5-chloro-2-(cyclobutylmethyl)-4-[2-(trifluoromethylsulfanyl)ethylamino]pyridazin-3-one.
| Compound Name | 5-chloro-2-(cyclobutylmethyl)-4-[2-(trifluoromethylsulfanyl)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 106430881 |
| Molecular Formula | C12H15ClF3N3OS |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 5-chloro-2-(cyclobutylmethyl)-4-[2-(trifluoromethylsulfanyl)ethylamino]pyridazin-3-one |
| SMILES | O=c1c(NCCSC(F)(F)F)c(Cl)cnn1CC1CCC1 |
| InChI | InChI=1S/C12H15ClF3N3OS/c13-9-6-18-19(7-8-2-1-3-8)11(20)10(9)17-4-5-21-12(14,15)16/h6,8,17H,1-5,7H2 |
| InChIKey | MYUCEFJZWCRJQG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|