C13H19ClN4O3 — CID 106239368
2-[2-[[5-chloro-2-(cyclobutylmethyl)-3-oxopyridazin-4-yl]amino]ethoxy]acetamide (PubChem CID 106239368) has the molecular formula C13H19ClN4O3 and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-[2-[[5-chloro-2-(cyclobutylmethyl)-3-oxopyridazin-4-yl]amino]ethoxy]acetamide.
| Compound Name | 2-[2-[[5-chloro-2-(cyclobutylmethyl)-3-oxopyridazin-4-yl]amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106239368 |
| Molecular Formula | C13H19ClN4O3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-[2-[[5-chloro-2-(cyclobutylmethyl)-3-oxopyridazin-4-yl]amino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1c(Cl)cnn(CC2CCC2)c1=O |
| InChI | InChI=1S/C13H19ClN4O3/c14-10-6-17-18(7-9-2-1-3-9)13(20)12(10)16-4-5-21-8-11(15)19/h6,9,16H,1-5,7-8H2,(H2,15,19) |
| InChIKey | JOKMIQSFZPARES-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|