C13H20ClN3O2 — CID 114438940
5-chloro-2-(cyclopropylmethyl)-4-(4-methoxybutan-2-ylamino)pyridazin-3-one (PubChem CID 114438940) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is 5-chloro-2-(cyclopropylmethyl)-4-(4-methoxybutan-2-ylamino)pyridazin-3-one.
| Compound Name | 5-chloro-2-(cyclopropylmethyl)-4-(4-methoxybutan-2-ylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114438940 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-chloro-2-(cyclopropylmethyl)-4-(4-methoxybutan-2-ylamino)pyridazin-3-one |
| SMILES | COCCC(C)Nc1c(Cl)cnn(CC2CC2)c1=O |
| InChI | InChI=1S/C13H20ClN3O2/c1-9(5-6-19-2)16-12-11(14)7-15-17(13(12)18)8-10-3-4-10/h7,9-10,16H,3-6,8H2,1-2H3 |
| InChIKey | FXMVYRDBVYEBAJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |