C16H26BrN3O — CID 114435361
5-bromo-2-(cyclobutylmethyl)-4-(heptan-2-ylamino)pyridazin-3-one (PubChem CID 114435361) has the molecular formula C16H26BrN3O and a molecular weight of 356.31 g/mol. Its IUPAC name is 5-bromo-2-(cyclobutylmethyl)-4-(heptan-2-ylamino)pyridazin-3-one.
| Compound Name | 5-bromo-2-(cyclobutylmethyl)-4-(heptan-2-ylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114435361 |
| Molecular Formula | C16H26BrN3O |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 5-bromo-2-(cyclobutylmethyl)-4-(heptan-2-ylamino)pyridazin-3-one |
| SMILES | CCCCCC(C)Nc1c(Br)cnn(CC2CCC2)c1=O |
| InChI | InChI=1S/C16H26BrN3O/c1-3-4-5-7-12(2)19-15-14(17)10-18-20(16(15)21)11-13-8-6-9-13/h10,12-13,19H,3-9,11H2,1-2H3 |
| InChIKey | YFUMBNILMVNRLF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|