C13H20BrN3O2S — CID 114442472
5-bromo-2-(cyclobutylmethyl)-4-(2-methylsulfinylpropylamino)pyridazin-3-one (PubChem CID 114442472) has the molecular formula C13H20BrN3O2S and a molecular weight of 362.29 g/mol. Its IUPAC name is 5-bromo-2-(cyclobutylmethyl)-4-(2-methylsulfinylpropylamino)pyridazin-3-one.
| Compound Name | 5-bromo-2-(cyclobutylmethyl)-4-(2-methylsulfinylpropylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114442472 |
| Molecular Formula | C13H20BrN3O2S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 5-bromo-2-(cyclobutylmethyl)-4-(2-methylsulfinylpropylamino)pyridazin-3-one |
| SMILES | CC(CNc1c(Br)cnn(CC2CCC2)c1=O)S(C)=O |
| InChI | InChI=1S/C13H20BrN3O2S/c1-9(20(2)19)6-15-12-11(14)7-16-17(13(12)18)8-10-4-3-5-10/h7,9-10,15H,3-6,8H2,1-2H3 |
| InChIKey | NWOMRRHIVPDWAU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |