C16H24BrN3O — CID 114436117
4-bromo-2-(cyclopropylmethyl)-5-[(2-methylcyclohexyl)methylamino]pyridazin-3-one (PubChem CID 114436117) has the molecular formula C16H24BrN3O and a molecular weight of 354.29 g/mol. Its IUPAC name is 4-bromo-2-(cyclopropylmethyl)-5-[(2-methylcyclohexyl)methylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(cyclopropylmethyl)-5-[(2-methylcyclohexyl)methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114436117 |
| Molecular Formula | C16H24BrN3O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-bromo-2-(cyclopropylmethyl)-5-[(2-methylcyclohexyl)methylamino]pyridazin-3-one |
| SMILES | CC1CCCCC1CNc1cnn(CC2CC2)c(=O)c1Br |
| InChI | InChI=1S/C16H24BrN3O/c1-11-4-2-3-5-13(11)8-18-14-9-19-20(10-12-6-7-12)16(21)15(14)17/h9,11-13,18H,2-8,10H2,1H3 |
| InChIKey | DZAVNJOAQCNYQY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |