C13H20ClN3O4 — CID 114436175
methyl 2-[[5-chloro-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]-3-methylbutanoate (PubChem CID 114436175) has the molecular formula C13H20ClN3O4 and a molecular weight of 317.77 g/mol. Its IUPAC name is methyl 2-[[5-chloro-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[5-chloro-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 114436175 |
| Molecular Formula | C13H20ClN3O4 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | methyl 2-[[5-chloro-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]-3-methylbutanoate |
| SMILES | COCCn1ncc(NC(C(=O)OC)C(C)C)c(Cl)c1=O |
| InChI | InChI=1S/C13H20ClN3O4/c1-8(2)11(13(19)21-4)16-9-7-15-17(5-6-20-3)12(18)10(9)14/h7-8,11,16H,5-6H2,1-4H3 |
| InChIKey | JOCKSLKNDQUAJS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |