C30H58O4Si — CID 11443621
(1R)-1-[(2S,5S)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]pent-4-en-1-ol (PubChem CID 11443621) has the molecular formula C30H58O4Si and a molecular weight of 510.88 g/mol. Its IUPAC name is (1R)-1-[(2S,5S)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]pent-4-en-1-ol.
| Compound Name | (1R)-1-[(2S,5S)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 11443621 |
| Molecular Formula | C30H58O4Si |
| Molecular Weight | 510.88 g/mol |
| Exact Mass | 510.41 |
| IUPAC Name | (1R)-1-[(2S,5S)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]pent-4-en-1-ol |
| SMILES | C=CCC[C@@H](O)[C@@H]1CC[C@@H]([C@@H]2CC[C@H]([C@@H](CCCCCCCCCC)O[Si](C)(C)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C30H58O4Si/c1-8-10-12-13-14-15-16-17-19-29(34-35(6,7)30(3,4)5)28-23-22-27(33-28)26-21-20-25(32-26)24(31)18-11-9-2/h9,24-29,31H,2,8,10-23H2,1,3-7H3/t24-,25+,26+,27+,28-,29-/m1/s1 |
| InChIKey | FQKZYILHAJMEEL-OROIKLIRSA-N |
| XLogP | 8.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.88 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|