C14H21BrN4O — CID 114436257
4-bromo-5-[(1-methylpiperidin-2-yl)methylamino]-2-prop-2-enylpyridazin-3-one (PubChem CID 114436257) has the molecular formula C14H21BrN4O and a molecular weight of 341.25 g/mol. Its IUPAC name is 4-bromo-5-[(1-methylpiperidin-2-yl)methylamino]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(1-methylpiperidin-2-yl)methylamino]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114436257 |
| Molecular Formula | C14H21BrN4O |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 4-bromo-5-[(1-methylpiperidin-2-yl)methylamino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCC2CCCCN2C)c(Br)c1=O |
| InChI | InChI=1S/C14H21BrN4O/c1-3-7-19-14(20)13(15)12(10-17-19)16-9-11-6-4-5-8-18(11)2/h3,10-11,16H,1,4-9H2,2H3 |
| InChIKey | NWKVNHGYQWNLHB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|