C13H19BrN4O2 — CID 114436813
4-bromo-2-butyl-5-[(2-oxopiperidin-3-yl)amino]pyridazin-3-one (PubChem CID 114436813) has the molecular formula C13H19BrN4O2 and a molecular weight of 343.23 g/mol. Its IUPAC name is 4-bromo-2-butyl-5-[(2-oxopiperidin-3-yl)amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-butyl-5-[(2-oxopiperidin-3-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114436813 |
| Molecular Formula | C13H19BrN4O2 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 4-bromo-2-butyl-5-[(2-oxopiperidin-3-yl)amino]pyridazin-3-one |
| SMILES | CCCCn1ncc(NC2CCCNC2=O)c(Br)c1=O |
| InChI | InChI=1S/C13H19BrN4O2/c1-2-3-7-18-13(20)11(14)10(8-16-18)17-9-5-4-6-15-12(9)19/h8-9,17H,2-7H2,1H3,(H,15,19) |
| InChIKey | DZANRIJZZGUIKZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |