C12H18BrN3O2 — CID 114440486
4-bromo-2-butyl-5-(oxolan-3-ylamino)pyridazin-3-one (PubChem CID 114440486) has the molecular formula C12H18BrN3O2 and a molecular weight of 316.20 g/mol. Its IUPAC name is 4-bromo-2-butyl-5-(oxolan-3-ylamino)pyridazin-3-one.
| Compound Name | 4-bromo-2-butyl-5-(oxolan-3-ylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114440486 |
| Molecular Formula | C12H18BrN3O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-bromo-2-butyl-5-(oxolan-3-ylamino)pyridazin-3-one |
| SMILES | CCCCn1ncc(NC2CCOC2)c(Br)c1=O |
| InChI | InChI=1S/C12H18BrN3O2/c1-2-3-5-16-12(17)11(13)10(7-14-16)15-9-4-6-18-8-9/h7,9,15H,2-6,8H2,1H3 |
| InChIKey | GCWQXIAXRLCVOR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |