C32H24N2O6 — CID 11443978
2-[4-[6-[4-(2-carboxyanilino)phenoxy]hexa-2,4-diynoxy]anilino]benzoic acid (PubChem CID 11443978) has the molecular formula C32H24N2O6 and a molecular weight of 532.55 g/mol. Its IUPAC name is 2-[4-[6-[4-(2-carboxyanilino)phenoxy]hexa-2,4-diynoxy]anilino]benzoic acid.
| Compound Name | 2-[4-[6-[4-(2-carboxyanilino)phenoxy]hexa-2,4-diynoxy]anilino]benzoic acid |
|---|---|
| PubChem CID | 11443978 |
| Molecular Formula | C32H24N2O6 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 2-[4-[6-[4-(2-carboxyanilino)phenoxy]hexa-2,4-diynoxy]anilino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1ccc(OCC#CC#CCOc2ccc(Nc3ccccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H24N2O6/c35-31(36)27-9-3-5-11-29(27)33-23-13-17-25(18-14-23)39-21-7-1-2-8-22-40-26-19-15-24(16-20-26)34-30-12-6-4-10-28(30)32(37)38/h3-6,9-20,33-34H,21-22H2,(H,35,36)(H,37,38) |
| InChIKey | XSWHXCMPZNKVAU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|