C14H22ClN3O2 — CID 114441321
4-chloro-2-ethyl-5-[[1-(hydroxymethyl)cyclohexyl]methylamino]pyridazin-3-one (PubChem CID 114441321) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 4-chloro-2-ethyl-5-[[1-(hydroxymethyl)cyclohexyl]methylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-ethyl-5-[[1-(hydroxymethyl)cyclohexyl]methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114441321 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-chloro-2-ethyl-5-[[1-(hydroxymethyl)cyclohexyl]methylamino]pyridazin-3-one |
| SMILES | CCn1ncc(NCC2(CO)CCCCC2)c(Cl)c1=O |
| InChI | InChI=1S/C14H22ClN3O2/c1-2-18-13(20)12(15)11(8-17-18)16-9-14(10-19)6-4-3-5-7-14/h8,16,19H,2-7,9-10H2,1H3 |
| InChIKey | KPKWUGXLSRTAHX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |