C16H18ClN3O3 — CID 133399133
2-benzyl-4-chloro-5-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]pyridazin-3-one (PubChem CID 133399133) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-benzyl-4-chloro-5-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]pyridazin-3-one.
| Compound Name | 2-benzyl-4-chloro-5-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 133399133 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-benzyl-4-chloro-5-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCC2(CO)COC2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C16H18ClN3O3/c17-14-13(18-8-16(9-21)10-23-11-16)6-19-20(15(14)22)7-12-4-2-1-3-5-12/h1-6,18,21H,7-11H2 |
| InChIKey | RMSMMGWTLLPKIF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |