C29H42N6O5 — CID 11444283
(8S,11S,14S)-14-amino-N,11-bis(4-aminobutyl)-5,17-dihydroxy-9-methyl-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxamide (PubChem CID 11444283) has the molecular formula C29H42N6O5 and a molecular weight of 554.69 g/mol. Its IUPAC name is (8S,11S,14S)-14-amino-N,11-bis(4-aminobutyl)-5,17-dihydroxy-9-methyl-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxamide.
| Compound Name | (8S,11S,14S)-14-amino-N,11-bis(4-aminobutyl)-5,17-dihydroxy-9-methyl-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxamide |
|---|---|
| PubChem CID | 11444283 |
| Molecular Formula | C29H42N6O5 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.32 |
| IUPAC Name | (8S,11S,14S)-14-amino-N,11-bis(4-aminobutyl)-5,17-dihydroxy-9-methyl-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxamide |
| SMILES | CN1C(=O)[C@H](CCCCN)NC(=O)[C@@H](N)Cc2cc(ccc2O)-c2ccc(O)c(c2)C[C@H]1C(=O)NCCCCN |
| InChI | InChI=1S/C29H42N6O5/c1-35-24(28(39)33-13-5-4-12-31)17-21-15-19(8-10-26(21)37)18-7-9-25(36)20(14-18)16-22(32)27(38)34-23(29(35)40)6-2-3-11-30/h7-10,14-15,22-24,36-37H,2-6,11-13,16-17,30-32H2,1H3,(H,33,39)(H,34,38)/t22-,23-,24-/m0/s1 |
| InChIKey | XUZWPHBOEAQXPB-HJOGWXRNSA-N |
| XLogP | 0.49 |
| TPSA | 197.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|