C25H32N4O6 — CID 143027409
(8S,11S)-14-amino-11-(4-aminobutyl)-5,17-dihydroxy-9-methyl-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylic acid (PubChem CID 143027409) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is (8S,11S)-14-amino-11-(4-aminobutyl)-5,17-dihydroxy-9-methyl-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylic acid.
| Compound Name | (8S,11S)-14-amino-11-(4-aminobutyl)-5,17-dihydroxy-9-methyl-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylic acid |
|---|---|
| PubChem CID | 143027409 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (8S,11S)-14-amino-11-(4-aminobutyl)-5,17-dihydroxy-9-methyl-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylic acid |
| SMILES | CN1C(=O)[C@H](CCCCN)NC(=O)C(N)Cc2cc(ccc2O)-c2ccc(O)c(c2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C25H32N4O6/c1-29-20(25(34)35)13-17-11-15(6-8-22(17)31)14-5-7-21(30)16(10-14)12-18(27)23(32)28-19(24(29)33)4-2-3-9-26/h5-8,10-11,18-20,30-31H,2-4,9,12-13,26-27H2,1H3,(H,28,32)(H,34,35)/t18?,19-,20-/m0/s1 |
| InChIKey | JHLRSANVYYTGIT-YPJRHXLCSA-N |
| XLogP | 0.72 |
| TPSA | 179.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|