C15H25BrN4O — CID 114443752
5-[(4-aminocyclohexyl)-methylamino]-4-bromo-2-(2-methylpropyl)pyridazin-3-one (PubChem CID 114443752) has the molecular formula C15H25BrN4O and a molecular weight of 357.30 g/mol. Its IUPAC name is 5-[(4-aminocyclohexyl)-methylamino]-4-bromo-2-(2-methylpropyl)pyridazin-3-one.
| Compound Name | 5-[(4-aminocyclohexyl)-methylamino]-4-bromo-2-(2-methylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114443752 |
| Molecular Formula | C15H25BrN4O |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 5-[(4-aminocyclohexyl)-methylamino]-4-bromo-2-(2-methylpropyl)pyridazin-3-one |
| SMILES | CC(C)Cn1ncc(N(C)C2CCC(N)CC2)c(Br)c1=O |
| InChI | InChI=1S/C15H25BrN4O/c1-10(2)9-20-15(21)14(16)13(8-18-20)19(3)12-6-4-11(17)5-7-12/h8,10-12H,4-7,9,17H2,1-3H3 |
| InChIKey | LSWCBBMIYXNYMR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |