C11H17BrN4O2 — CID 114444964
4-bromo-2-(2-hydroxyethyl)-5-[methyl(pyrrolidin-3-yl)amino]pyridazin-3-one (PubChem CID 114444964) has the molecular formula C11H17BrN4O2 and a molecular weight of 317.19 g/mol. Its IUPAC name is 4-bromo-2-(2-hydroxyethyl)-5-[methyl(pyrrolidin-3-yl)amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-hydroxyethyl)-5-[methyl(pyrrolidin-3-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114444964 |
| Molecular Formula | C11H17BrN4O2 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-bromo-2-(2-hydroxyethyl)-5-[methyl(pyrrolidin-3-yl)amino]pyridazin-3-one |
| SMILES | CN(c1cnn(CCO)c(=O)c1Br)C1CCNC1 |
| InChI | InChI=1S/C11H17BrN4O2/c1-15(8-2-3-13-6-8)9-7-14-16(4-5-17)11(18)10(9)12/h7-8,13,17H,2-6H2,1H3 |
| InChIKey | KCWVGUFQROMBLA-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |