C14H23ClN4O — CID 114444353
5-[3-(aminomethyl)piperidin-1-yl]-2-butyl-4-chloropyridazin-3-one (PubChem CID 114444353) has the molecular formula C14H23ClN4O and a molecular weight of 298.82 g/mol. Its IUPAC name is 5-[3-(aminomethyl)piperidin-1-yl]-2-butyl-4-chloropyridazin-3-one.
| Compound Name | 5-[3-(aminomethyl)piperidin-1-yl]-2-butyl-4-chloropyridazin-3-one |
|---|---|
| PubChem CID | 114444353 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 5-[3-(aminomethyl)piperidin-1-yl]-2-butyl-4-chloropyridazin-3-one |
| SMILES | CCCCn1ncc(N2CCCC(CN)C2)c(Cl)c1=O |
| InChI | InChI=1S/C14H23ClN4O/c1-2-3-7-19-14(20)13(15)12(9-17-19)18-6-4-5-11(8-16)10-18/h9,11H,2-8,10,16H2,1H3 |
| InChIKey | OVOLQSOVOZKIQM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |