C13H19BrN4O — CID 114444351
5-[3-(aminomethyl)piperidin-1-yl]-4-bromo-2-prop-2-enylpyridazin-3-one (PubChem CID 114444351) has the molecular formula C13H19BrN4O and a molecular weight of 327.23 g/mol. Its IUPAC name is 5-[3-(aminomethyl)piperidin-1-yl]-4-bromo-2-prop-2-enylpyridazin-3-one.
| Compound Name | 5-[3-(aminomethyl)piperidin-1-yl]-4-bromo-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114444351 |
| Molecular Formula | C13H19BrN4O |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 5-[3-(aminomethyl)piperidin-1-yl]-4-bromo-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(N2CCCC(CN)C2)c(Br)c1=O |
| InChI | InChI=1S/C13H19BrN4O/c1-2-5-18-13(19)12(14)11(8-16-18)17-6-3-4-10(7-15)9-17/h2,8,10H,1,3-7,9,15H2 |
| InChIKey | BKZTZJRMKFVWAC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|