C15H23ClN4O — CID 114443666
4-chloro-5-[3-[1-(methylamino)ethyl]piperidin-1-yl]-2-prop-2-enylpyridazin-3-one (PubChem CID 114443666) has the molecular formula C15H23ClN4O and a molecular weight of 310.83 g/mol. Its IUPAC name is 4-chloro-5-[3-[1-(methylamino)ethyl]piperidin-1-yl]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-chloro-5-[3-[1-(methylamino)ethyl]piperidin-1-yl]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114443666 |
| Molecular Formula | C15H23ClN4O |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 4-chloro-5-[3-[1-(methylamino)ethyl]piperidin-1-yl]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(N2CCCC(C(C)NC)C2)c(Cl)c1=O |
| InChI | InChI=1S/C15H23ClN4O/c1-4-7-20-15(21)14(16)13(9-18-20)19-8-5-6-12(10-19)11(2)17-3/h4,9,11-12,17H,1,5-8,10H2,2-3H3 |
| InChIKey | KKWAWUVLGZZEQI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|