C10H17ClN4O — CID 114444670
5-[2-aminoethyl(methyl)amino]-4-chloro-2-propan-2-ylpyridazin-3-one (PubChem CID 114444670) has the molecular formula C10H17ClN4O and a molecular weight of 244.73 g/mol. Its IUPAC name is 5-[2-aminoethyl(methyl)amino]-4-chloro-2-propan-2-ylpyridazin-3-one.
| Compound Name | 5-[2-aminoethyl(methyl)amino]-4-chloro-2-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 114444670 |
| Molecular Formula | C10H17ClN4O |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5-[2-aminoethyl(methyl)amino]-4-chloro-2-propan-2-ylpyridazin-3-one |
| SMILES | CC(C)n1ncc(N(C)CCN)c(Cl)c1=O |
| InChI | InChI=1S/C10H17ClN4O/c1-7(2)15-10(16)9(11)8(6-13-15)14(3)5-4-12/h6-7H,4-5,12H2,1-3H3 |
| InChIKey | WEEXVKBYTZBIML-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |