C11H17ClN4O3 — CID 114447027
methyl 2-[4-[3-aminopropyl(methyl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate (PubChem CID 114447027) has the molecular formula C11H17ClN4O3 and a molecular weight of 288.74 g/mol. Its IUPAC name is methyl 2-[4-[3-aminopropyl(methyl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[3-aminopropyl(methyl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114447027 |
| Molecular Formula | C11H17ClN4O3 |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | methyl 2-[4-[3-aminopropyl(methyl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(N(C)CCCN)c(Cl)c1=O |
| InChI | InChI=1S/C11H17ClN4O3/c1-15(5-3-4-13)8-6-14-16(7-9(17)19-2)11(18)10(8)12/h6H,3-5,7,13H2,1-2H3 |
| InChIKey | QXRFEHWLQNETRE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |