C8H9ClN2O4 — CID 162727923
methyl 2-[4-chloro-5-(hydroxymethyl)-6-oxopyridazin-1-yl]acetate (PubChem CID 162727923) has the molecular formula C8H9ClN2O4 and a molecular weight of 232.62 g/mol. Its IUPAC name is methyl 2-[4-chloro-5-(hydroxymethyl)-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[4-chloro-5-(hydroxymethyl)-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 162727923 |
| Molecular Formula | C8H9ClN2O4 |
| Molecular Weight | 232.62 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | methyl 2-[4-chloro-5-(hydroxymethyl)-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(Cl)c(CO)c1=O |
| InChI | InChI=1S/C8H9ClN2O4/c1-15-7(13)3-11-8(14)5(4-12)6(9)2-10-11/h2,12H,3-4H2,1H3 |
| InChIKey | HSHSBJOSJMURGU-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.62 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |