C9H13ClN2O2 — CID 154882133
methyl 2-(4-chloro-5-propan-2-ylpyrazol-1-yl)acetate (PubChem CID 154882133) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is methyl 2-(4-chloro-5-propan-2-ylpyrazol-1-yl)acetate.
| Compound Name | methyl 2-(4-chloro-5-propan-2-ylpyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 154882133 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | methyl 2-(4-chloro-5-propan-2-ylpyrazol-1-yl)acetate |
| SMILES | COC(=O)Cn1ncc(Cl)c1C(C)C |
| InChI | InChI=1S/C9H13ClN2O2/c1-6(2)9-7(10)4-11-12(9)5-8(13)14-3/h4,6H,5H2,1-3H3 |
| InChIKey | FSJQSUORIKOXON-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |