C12H17ClN4O3 — CID 114446007
methyl 2-[4-[azetidin-3-yl(ethyl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate (PubChem CID 114446007) has the molecular formula C12H17ClN4O3 and a molecular weight of 300.75 g/mol. Its IUPAC name is methyl 2-[4-[azetidin-3-yl(ethyl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[azetidin-3-yl(ethyl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114446007 |
| Molecular Formula | C12H17ClN4O3 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | methyl 2-[4-[azetidin-3-yl(ethyl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate |
| SMILES | CCN(c1cnn(CC(=O)OC)c(=O)c1Cl)C1CNC1 |
| InChI | InChI=1S/C12H17ClN4O3/c1-3-16(8-4-14-5-8)9-6-15-17(7-10(18)20-2)12(19)11(9)13/h6,8,14H,3-5,7H2,1-2H3 |
| InChIKey | CWIFDEGXEMSMSQ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |