C28H26N2O5 — CID 11444510
2,9-dimethoxy-11-(3,4,5-trimethoxyphenyl)benzo[c]phenanthridin-6-amine (PubChem CID 11444510) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2,9-dimethoxy-11-(3,4,5-trimethoxyphenyl)benzo[c]phenanthridin-6-amine.
| Compound Name | 2,9-dimethoxy-11-(3,4,5-trimethoxyphenyl)benzo[c]phenanthridin-6-amine |
|---|---|
| PubChem CID | 11444510 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2,9-dimethoxy-11-(3,4,5-trimethoxyphenyl)benzo[c]phenanthridin-6-amine |
| SMILES | COc1ccc2c(c1)cc(-c1cc(OC)c(OC)c(OC)c1)c1c3cc(OC)ccc3c(N)nc21 |
| InChI | InChI=1S/C28H26N2O5/c1-31-17-6-8-19-15(10-17)11-21(16-12-23(33-3)27(35-5)24(13-16)34-4)25-22-14-18(32-2)7-9-20(22)28(29)30-26(19)25/h6-14H,1-5H3,(H2,29,30) |
| InChIKey | QBAMANBMRJIDJB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|