C13H20ClN5O2 — CID 114446079
4-chloro-2-(2-hydroxyethyl)-5-(3-piperazin-1-ylazetidin-1-yl)pyridazin-3-one (PubChem CID 114446079) has the molecular formula C13H20ClN5O2 and a molecular weight of 313.79 g/mol. Its IUPAC name is 4-chloro-2-(2-hydroxyethyl)-5-(3-piperazin-1-ylazetidin-1-yl)pyridazin-3-one.
| Compound Name | 4-chloro-2-(2-hydroxyethyl)-5-(3-piperazin-1-ylazetidin-1-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 114446079 |
| Molecular Formula | C13H20ClN5O2 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-chloro-2-(2-hydroxyethyl)-5-(3-piperazin-1-ylazetidin-1-yl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CC(N3CCNCC3)C2)cnn1CCO |
| InChI | InChI=1S/C13H20ClN5O2/c14-12-11(7-16-19(5-6-20)13(12)21)18-8-10(9-18)17-3-1-15-2-4-17/h7,10,15,20H,1-6,8-9H2 |
| InChIKey | RWTWHSBJUMDCEV-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |