C13H19ClN4O3 — CID 114445817
1-(1-butyl-5-chloro-6-oxopyridazin-4-yl)piperazine-2-carboxylic acid (PubChem CID 114445817) has the molecular formula C13H19ClN4O3 and a molecular weight of 314.77 g/mol. Its IUPAC name is 1-(1-butyl-5-chloro-6-oxopyridazin-4-yl)piperazine-2-carboxylic acid.
| Compound Name | 1-(1-butyl-5-chloro-6-oxopyridazin-4-yl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 114445817 |
| Molecular Formula | C13H19ClN4O3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-(1-butyl-5-chloro-6-oxopyridazin-4-yl)piperazine-2-carboxylic acid |
| SMILES | CCCCn1ncc(N2CCNCC2C(=O)O)c(Cl)c1=O |
| InChI | InChI=1S/C13H19ClN4O3/c1-2-3-5-18-12(19)11(14)9(8-16-18)17-6-4-15-7-10(17)13(20)21/h8,10,15H,2-7H2,1H3,(H,20,21) |
| InChIKey | CDFPUYXQFDOFOW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |