C14H23ClN4O — CID 114445784
2-butyl-4-chloro-5-(2,2-dimethylpiperazin-1-yl)pyridazin-3-one (PubChem CID 114445784) has the molecular formula C14H23ClN4O and a molecular weight of 298.82 g/mol. Its IUPAC name is 2-butyl-4-chloro-5-(2,2-dimethylpiperazin-1-yl)pyridazin-3-one.
| Compound Name | 2-butyl-4-chloro-5-(2,2-dimethylpiperazin-1-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 114445784 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-butyl-4-chloro-5-(2,2-dimethylpiperazin-1-yl)pyridazin-3-one |
| SMILES | CCCCn1ncc(N2CCNCC2(C)C)c(Cl)c1=O |
| InChI | InChI=1S/C14H23ClN4O/c1-4-5-7-19-13(20)12(15)11(9-17-19)18-8-6-16-10-14(18,2)3/h9,16H,4-8,10H2,1-3H3 |
| InChIKey | VBWNOPVTJKGIDI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |