C14H23ClN4O2 — CID 114446630
2-butyl-4-chloro-5-[methyl(morpholin-2-ylmethyl)amino]pyridazin-3-one (PubChem CID 114446630) has the molecular formula C14H23ClN4O2 and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-butyl-4-chloro-5-[methyl(morpholin-2-ylmethyl)amino]pyridazin-3-one.
| Compound Name | 2-butyl-4-chloro-5-[methyl(morpholin-2-ylmethyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114446630 |
| Molecular Formula | C14H23ClN4O2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-butyl-4-chloro-5-[methyl(morpholin-2-ylmethyl)amino]pyridazin-3-one |
| SMILES | CCCCn1ncc(N(C)CC2CNCCO2)c(Cl)c1=O |
| InChI | InChI=1S/C14H23ClN4O2/c1-3-4-6-19-14(20)13(15)12(9-17-19)18(2)10-11-8-16-5-7-21-11/h9,11,16H,3-8,10H2,1-2H3 |
| InChIKey | CIRFZDPUEXTIHU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |